C22H26N2O2S — CID 4291829
N-(1,3-benzothiazol-2-yl)-N-hexyl-2-phenoxypropanamide (PubChem CID 4291829) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-hexyl-2-phenoxypropanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-hexyl-2-phenoxypropanamide |
|---|---|
| PubChem CID | 4291829 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-hexyl-2-phenoxypropanamide |
| SMILES | CCCCCCN(C(=O)C(C)Oc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H26N2O2S/c1-3-4-5-11-16-24(22-23-19-14-9-10-15-20(19)27-22)21(25)17(2)26-18-12-7-6-8-13-18/h6-10,12-15,17H,3-5,11,16H2,1-2H3 |
| InChIKey | AXLZRVMDSODCRO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|