C19H22N4 — CID 3337514
N,N-diethyl-4-[(1-methylbenzimidazol-2-yl)iminomethyl]aniline (PubChem CID 3337514) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N,N-diethyl-4-[(1-methylbenzimidazol-2-yl)iminomethyl]aniline.
| Compound Name | N,N-diethyl-4-[(1-methylbenzimidazol-2-yl)iminomethyl]aniline |
|---|---|
| PubChem CID | 3337514 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N,N-diethyl-4-[(1-methylbenzimidazol-2-yl)iminomethyl]aniline |
| SMILES | CCN(CC)c1ccc(C=Nc2nc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C19H22N4/c1-4-23(5-2)16-12-10-15(11-13-16)14-20-19-21-17-8-6-7-9-18(17)22(19)3/h6-14H,4-5H2,1-3H3 |
| InChIKey | HPIVMJXLONEMOJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|