C22H27N4O+ — CID 5170986
1-(4-methoxyphenyl)-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]methanimine (PubChem CID 5170986) has the molecular formula C22H27N4O+ and a molecular weight of 363.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]methanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]methanimine |
|---|---|
| PubChem CID | 5170986 |
| Molecular Formula | C22H27N4O+ |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]methanimine |
| SMILES | COc1ccc(C=Nc2nc3ccccc3n2CC[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-27-19-11-9-18(10-12-19)17-23-22-24-20-7-3-4-8-21(20)26(22)16-15-25-13-5-2-6-14-25/h3-4,7-12,17H,2,5-6,13-16H2,1H3/p+1 |
| InChIKey | HWAGDFPPWSZCFV-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 43.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|