C24H26N4O2 — CID 3746017
2-[2-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 3746017) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[2-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 3746017 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[2-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | COc1ccc(C=Nc2nc3ccccc3n2CCN(C)C)c2c(OC)cccc12 |
| InChI | InChI=1S/C24H26N4O2/c1-27(2)14-15-28-20-10-6-5-9-19(20)26-24(28)25-16-17-12-13-21(29-3)18-8-7-11-22(30-4)23(17)18/h5-13,16H,14-15H2,1-4H3 |
| InChIKey | VISYGFGYLHSDLA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|