C21H24N6 — CID 1212470
2-[2-[(1-ethylbenzimidazol-2-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 1212470) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-[2-[(1-ethylbenzimidazol-2-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(1-ethylbenzimidazol-2-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 1212470 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[2-[(1-ethylbenzimidazol-2-yl)methylideneamino]benzimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CCn1c(C=Nc2nc3ccccc3n2CCN(C)C)nc2ccccc21 |
| InChI | InChI=1S/C21H24N6/c1-4-26-18-11-7-5-9-16(18)23-20(26)15-22-21-24-17-10-6-8-12-19(17)27(21)14-13-25(2)3/h5-12,15H,4,13-14H2,1-3H3 |
| InChIKey | CNRWENSXHHFZOR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|