C46H44N2O4 — CID 59982740
2-methoxyethyl 3-[4-(N-[4-[4-(N-[4-(3-oxobutyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoate (PubChem CID 59982740) has the molecular formula C46H44N2O4 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2-methoxyethyl 3-[4-(N-[4-[4-(N-[4-(3-oxobutyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoate.
| Compound Name | 2-methoxyethyl 3-[4-(N-[4-[4-(N-[4-(3-oxobutyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoate |
|---|---|
| PubChem CID | 59982740 |
| Molecular Formula | C46H44N2O4 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | 2-methoxyethyl 3-[4-(N-[4-[4-(N-[4-(3-oxobutyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoate |
| SMILES | COCCOC(=O)CCc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc(CCC(C)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H44N2O4/c1-35(49)13-14-36-15-24-42(25-16-36)47(40-9-5-3-6-10-40)44-28-20-38(21-29-44)39-22-30-45(31-23-39)48(41-11-7-4-8-12-41)43-26-17-37(18-27-43)19-32-46(50)52-34-33-51-2/h3-12,15-18,20-31H,13-14,19,32-34H2,1-2H3 |
| InChIKey | KXCHZDYUHWPBCP-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|