C50H46O4 — CID 59809384
2-methoxyethyl 3-[4-[2-[4-[4-[2-[4-(3-oxobutyl)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]phenyl]propanoate (PubChem CID 59809384) has the molecular formula C50H46O4 and a molecular weight of 710.91 g/mol. Its IUPAC name is 2-methoxyethyl 3-[4-[2-[4-[4-[2-[4-(3-oxobutyl)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]phenyl]propanoate.
| Compound Name | 2-methoxyethyl 3-[4-[2-[4-[4-[2-[4-(3-oxobutyl)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 59809384 |
| Molecular Formula | C50H46O4 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | 2-methoxyethyl 3-[4-[2-[4-[4-[2-[4-(3-oxobutyl)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]phenyl]propanoate |
| SMILES | COCCOC(=O)CCc1ccc(C(=Cc2ccc(-c3ccc(C=C(c4ccccc4)c4ccc(CCC(C)=O)cc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H46O4/c1-37(51)13-14-38-15-28-46(29-16-38)48(44-9-5-3-6-10-44)35-40-19-24-42(25-20-40)43-26-21-41(22-27-43)36-49(45-11-7-4-8-12-45)47-30-17-39(18-31-47)23-32-50(52)54-34-33-53-2/h3-12,15-22,24-31,35-36H,13-14,23,32-34H2,1-2H3 |
| InChIKey | PXBPAECJYZQTMO-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|