C41H34Si — CID 123788306
[4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]phenyl]-1-phenylethenyl]phenyl]-methylsilane (PubChem CID 123788306) has the molecular formula C41H34Si and a molecular weight of 554.81 g/mol. Its IUPAC name is [4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]phenyl]-1-phenylethenyl]phenyl]-methylsilane.
| Compound Name | [4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]phenyl]-1-phenylethenyl]phenyl]-methylsilane |
|---|---|
| PubChem CID | 123788306 |
| Molecular Formula | C41H34Si |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]phenyl]-1-phenylethenyl]phenyl]-methylsilane |
| SMILES | C[SiH2]c1ccc(C(=Cc2ccc(-c3ccc(C=C(c4ccccc4)c4ccccc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H34Si/c1-42-39-27-25-38(26-28-39)41(37-15-9-4-10-16-37)30-32-19-23-34(24-20-32)33-21-17-31(18-22-33)29-40(35-11-5-2-6-12-35)36-13-7-3-8-14-36/h2-30H,42H2,1H3 |
| InChIKey | SVJWMDUXUZLNBJ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|