C42H55NO4Si2 — CID 58599069
3-[dimethyl-[4-[4-[3-oxo-3-(3-trimethylsilylpropoxy)propyl]-N-(4-phenylphenyl)anilino]phenyl]silyl]propyl butanoate (PubChem CID 58599069) has the molecular formula C42H55NO4Si2 and a molecular weight of 694.08 g/mol. Its IUPAC name is 3-[dimethyl-[4-[4-[3-oxo-3-(3-trimethylsilylpropoxy)propyl]-N-(4-phenylphenyl)anilino]phenyl]silyl]propyl butanoate.
| Compound Name | 3-[dimethyl-[4-[4-[3-oxo-3-(3-trimethylsilylpropoxy)propyl]-N-(4-phenylphenyl)anilino]phenyl]silyl]propyl butanoate |
|---|---|
| PubChem CID | 58599069 |
| Molecular Formula | C42H55NO4Si2 |
| Molecular Weight | 694.08 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | 3-[dimethyl-[4-[4-[3-oxo-3-(3-trimethylsilylpropoxy)propyl]-N-(4-phenylphenyl)anilino]phenyl]silyl]propyl butanoate |
| SMILES | CCCC(=O)OCCC[Si](C)(C)c1ccc(N(c2ccc(CCC(=O)OCCC[Si](C)(C)C)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H55NO4Si2/c1-7-13-41(44)46-31-12-33-49(5,6)40-27-25-39(26-28-40)43(38-23-19-36(20-24-38)35-14-9-8-10-15-35)37-21-16-34(17-22-37)18-29-42(45)47-30-11-32-48(2,3)4/h8-10,14-17,19-28H,7,11-13,18,29-33H2,1-6H3 |
| InChIKey | AOBYZOGGUBMLIY-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.08 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|