C74H84N2O4 — CID 89212523
2-(2-methylnonan-2-yloxy)ethyl 3-[4-(N-[4-[4-[4-(4,4-dimethyl-3-oxononyl)-N-(4-phenylphenyl)anilino]phenyl]phenyl]-4-phenylanilino)phenyl]propanoate (PubChem CID 89212523) has the molecular formula C74H84N2O4 and a molecular weight of 1065.50 g/mol. Its IUPAC name is 2-(2-methylnonan-2-yloxy)ethyl 3-[4-(N-[4-[4-[4-(4,4-dimethyl-3-oxononyl)-N-(4-phenylphenyl)anilino]phenyl]phenyl]-4-phenylanilino)phenyl]propanoate.
| Compound Name | 2-(2-methylnonan-2-yloxy)ethyl 3-[4-(N-[4-[4-[4-(4,4-dimethyl-3-oxononyl)-N-(4-phenylphenyl)anilino]phenyl]phenyl]-4-phenylanilino)phenyl]propanoate |
|---|---|
| PubChem CID | 89212523 |
| Molecular Formula | C74H84N2O4 |
| Molecular Weight | 1065.50 g/mol |
| Exact Mass | 1064.64 |
| IUPAC Name | 2-(2-methylnonan-2-yloxy)ethyl 3-[4-(N-[4-[4-[4-(4,4-dimethyl-3-oxononyl)-N-(4-phenylphenyl)anilino]phenyl]phenyl]-4-phenylanilino)phenyl]propanoate |
| SMILES | CCCCCCCC(C)(C)OCCOC(=O)CCc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(N(c4ccc(CCC(=O)C(C)(C)CCCCC)cc4)c4ccc(-c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C74H84N2O4/c1-7-9-11-12-20-54-74(5,6)80-56-55-79-72(78)52-30-58-27-41-66(42-28-58)76(68-45-33-62(34-46-68)60-23-17-14-18-24-60)70-49-37-64(38-50-70)63-35-47-69(48-36-63)75(67-43-31-61(32-44-67)59-21-15-13-16-22-59)65-39-25-57(26-40-65)29-51-71(77)73(3,4)53-19-10-8-2/h13-18,21-28,31-50H,7-12,19-20,29-30,51-56H2,1-6H3 |
| InChIKey | WBKJKCZCUCDRBH-UHFFFAOYSA-N |
| XLogP | 20.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.50 |
| LogP ≤ 5 | 20.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|