About 2-nitroethyl 3-phenylpropanoate
2-nitroethyl 3-phenylpropanoate (PubChem CID 102215947) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-nitroethyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | 2-nitroethyl 3-phenylpropanoate |
| PubChem CID | 102215947 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-nitroethyl 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OCC[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO4/c13-11(16-9-8-12(14)15)7-6-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | DDMITEHYLWETDO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethyl 3-phenylpropanoate?
The IUPAC name of 2-nitroethyl 3-phenylpropanoate (CID 102215947) is 2-nitroethyl 3-phenylpropanoate.
What is the SMILES notation for 2-nitroethyl 3-phenylpropanoate?
The canonical SMILES for 2-nitroethyl 3-phenylpropanoate is O=C(CCc1ccccc1)OCC[N+](=O)[O-].
What is the InChIKey of 2-nitroethyl 3-phenylpropanoate?
The InChIKey is DDMITEHYLWETDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c13-11(16-9-8-12(14)15)7-6-10-4-2-1-3-5-10/h1-5H,6-9H2.
What are the key properties of 2-nitroethyl 3-phenylpropanoate?
2-nitroethyl 3-phenylpropanoate has a molecular weight of 223.23 g/mol, XLogP of 1.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethyl 3-phenylpropanoate is sourced from PubChem (CID 102215947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).