C28H38N2O4S — CID 30377287
[(Z)-hex-3-enyl] 2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethoxy]benzoate (PubChem CID 30377287) has the molecular formula C28H38N2O4S and a molecular weight of 498.69 g/mol. Its IUPAC name is [(Z)-hex-3-enyl] 2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethoxy]benzoate.
| Compound Name | [(Z)-hex-3-enyl] 2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 30377287 |
| Molecular Formula | C28H38N2O4S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(Z)-hex-3-enyl] 2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethoxy]benzoate |
| SMILES | CC/C=C\CCOC(=O)c1ccccc1OCC(=O)Nc1nc2c(s1)CCCCCCCCCC2 |
| InChI | InChI=1S/C28H38N2O4S/c1-2-3-4-15-20-33-27(32)22-16-13-14-18-24(22)34-21-26(31)30-28-29-23-17-11-9-7-5-6-8-10-12-19-25(23)35-28/h3-4,13-14,16,18H,2,5-12,15,17,19-21H2,1H3,(H,29,30,31)/b4-3- |
| InChIKey | WXMRFFJEPIEVMS-ARJAWSKDSA-N |
| XLogP | 6.89 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|