C32H48N4O5S — CID 43904254
2-ethylhexyl 2-[2-[2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 43904254) has the molecular formula C32H48N4O5S and a molecular weight of 600.83 g/mol. Its IUPAC name is 2-ethylhexyl 2-[2-[2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | 2-ethylhexyl 2-[2-[2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 43904254 |
| Molecular Formula | C32H48N4O5S |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-ethylhexyl 2-[2-[2-[2-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-ylamino)-2-oxoethyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1OCC(=O)NNCC(=O)Nc1nc2c(s1)CCCCCCCCCC2 |
| InChI | InChI=1S/C32H48N4O5S/c1-3-5-16-24(4-2)22-41-31(39)25-17-14-15-19-27(25)40-23-30(38)36-33-21-29(37)35-32-34-26-18-12-10-8-6-7-9-11-13-20-28(26)42-32/h14-15,17,19,24,33H,3-13,16,18,20-23H2,1-2H3,(H,36,38)(H,34,35,37) |
| InChIKey | CZKCYEXUKGURTJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|