About methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide
methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 139434250) has the molecular formula C13H11F3N4O3
and a molecular weight of 328.25 g/mol. Its IUPAC name is methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide |
| PubChem CID | 139434250 |
| Molecular Formula | C13H11F3N4O3 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | COC(=O)c1cccnc1.NC(=O)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C7H7NO2.C6H4F3N3O/c1-10-7(9)6-3-2-4-8-5-6;7-6(8,9)5-11-1-3(2-12-5)4(10)13/h2-5H,1H3;1-2H,(H2,10,13) |
| InChIKey | PGXCGAKLCPKMPQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide?
The IUPAC name of methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide (CID 139434250) is methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide.
What is the SMILES notation for methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide?
The canonical SMILES for methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide is COC(=O)c1cccnc1.NC(=O)c1cnc(C(F)(F)F)nc1.
What is the InChIKey of methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide?
The InChIKey is PGXCGAKLCPKMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H4F3N3O/c1-10-7(9)6-3-2-4-8-5-6;7-6(8,9)5-11-1-3(2-12-5)4(10)13/h2-5H,1H3;1-2H,(H2,10,13).
What are the key properties of methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide?
methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide has a molecular weight of 328.25 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyridine-3-carboxylate;2-(trifluoromethyl)pyrimidine-5-carboxamide is sourced from PubChem (CID 139434250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).