C20H14ClF3N4O7S — CID 54759172
2-chloro-4-nitro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 54759172) has the molecular formula C20H14ClF3N4O7S and a molecular weight of 546.87 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-4-nitro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54759172 |
| Molecular Formula | C20H14ClF3N4O7S |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | 2-chloro-4-nitro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1ccc([N+](=O)[O-])cc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H13ClN4O5S.C2HF3O2/c19-16-11-13(23(25)26)6-9-15(16)18(24)21-12-4-7-14(8-5-12)29(27,28)22-17-3-1-2-10-20-17;3-2(4,5)1(6)7/h1-11H,(H,20,22)(H,21,24);(H,6,7) |
| InChIKey | LLARSPWYATVTNG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|