C11H9N3O4S — CID 63872213
6-(pyridin-2-ylsulfamoyl)pyridine-3-carboxylic acid (PubChem CID 63872213) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is 6-(pyridin-2-ylsulfamoyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(pyridin-2-ylsulfamoyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63872213 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 6-(pyridin-2-ylsulfamoyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccccn2)nc1 |
| InChI | InChI=1S/C11H9N3O4S/c15-11(16)8-4-5-10(13-7-8)19(17,18)14-9-3-1-2-6-12-9/h1-7H,(H,12,14)(H,15,16) |
| InChIKey | QZBPFKNGUTVVCK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |