C26H29N3O5S2 — CID 3982967
4-methyl-3-[(2-methylphenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 3982967) has the molecular formula C26H29N3O5S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-methyl-3-[(2-methylphenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-methyl-3-[(2-methylphenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3982967 |
| Molecular Formula | C26H29N3O5S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 4-methyl-3-[(2-methylphenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)ccc1C |
| InChI | InChI=1S/C26H29N3O5S2/c1-19-8-4-5-9-24(19)28-35(31,32)25-18-21(11-10-20(25)2)26(30)27-22-12-14-23(15-13-22)36(33,34)29-16-6-3-7-17-29/h4-5,8-15,18,28H,3,6-7,16-17H2,1-2H3,(H,27,30) |
| InChIKey | MJWMRCPSHYMJKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |