C24H24ClN3O3S — CID 100503088
4-chloro-3-[(2-methylphenyl)sulfamoyl]-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 100503088) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is 4-chloro-3-[(2-methylphenyl)sulfamoyl]-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-chloro-3-[(2-methylphenyl)sulfamoyl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 100503088 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 4-chloro-3-[(2-methylphenyl)sulfamoyl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2ccc(N3CCCC3)cc2)ccc1Cl |
| InChI | InChI=1S/C24H24ClN3O3S/c1-17-6-2-3-7-22(17)27-32(30,31)23-16-18(8-13-21(23)25)24(29)26-19-9-11-20(12-10-19)28-14-4-5-15-28/h2-3,6-13,16,27H,4-5,14-15H2,1H3,(H,26,29) |
| InChIKey | GELCTUFYKHFFAT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|