C13H13N5O2 — CID 82222745
ethyl 5-amino-1-[(2-cyanophenyl)methyl]triazole-4-carboxylate (PubChem CID 82222745) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is ethyl 5-amino-1-[(2-cyanophenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[(2-cyanophenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 82222745 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | ethyl 5-amino-1-[(2-cyanophenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccccc2C#N)c1N |
| InChI | InChI=1S/C13H13N5O2/c1-2-20-13(19)11-12(15)18(17-16-11)8-10-6-4-3-5-9(10)7-14/h3-6H,2,8,15H2,1H3 |
| InChIKey | GDJFAAISOVGBGD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |