C12H11N5O — CID 107345205
4-amino-1-[(2-cyanophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 107345205) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-amino-1-[(2-cyanophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[(2-cyanophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345205 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-amino-1-[(2-cyanophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | N#Cc1ccccc1Cn1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C12H11N5O/c13-5-8-3-1-2-4-9(8)6-17-7-10(14)11(16-17)12(15)18/h1-4,7H,6,14H2,(H2,15,18) |
| InChIKey | UJAXZESBGMSVIT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |