C13H16BrN3O2S — CID 103112821
2-methylpropyl 1-[(3-bromothiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103112821) has the molecular formula C13H16BrN3O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is 2-methylpropyl 1-[(3-bromothiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | 2-methylpropyl 1-[(3-bromothiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103112821 |
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2-methylpropyl 1-[(3-bromothiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(C)C)nnn1Cc1sccc1Br |
| InChI | InChI=1S/C13H16BrN3O2S/c1-8(2)7-19-13(18)12-9(3)17(16-15-12)6-11-10(14)4-5-20-11/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | GXZYPZFGZMONOV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |