C14H21N5O2 — CID 103112824
2-methylpropyl 5-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]triazole-4-carboxylate (PubChem CID 103112824) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-methylpropyl 5-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]triazole-4-carboxylate.
| Compound Name | 2-methylpropyl 5-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103112824 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-methylpropyl 5-methyl-1-[2-(2-methylimidazol-1-yl)ethyl]triazole-4-carboxylate |
| SMILES | Cc1nccn1CCn1nnc(C(=O)OCC(C)C)c1C |
| InChI | InChI=1S/C14H21N5O2/c1-10(2)9-21-14(20)13-11(3)19(17-16-13)8-7-18-6-5-15-12(18)4/h5-6,10H,7-9H2,1-4H3 |
| InChIKey | LCIPEGARCQTUFD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |