C11H12BrN3O3S — CID 102645799
1-[(3-bromothiophen-2-yl)methyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid (PubChem CID 102645799) has the molecular formula C11H12BrN3O3S and a molecular weight of 346.21 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645799 |
| Molecular Formula | C11H12BrN3O3S |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid |
| SMILES | COCCc1c(C(=O)O)nnn1Cc1sccc1Br |
| InChI | InChI=1S/C11H12BrN3O3S/c1-18-4-2-8-10(11(16)17)13-14-15(8)6-9-7(12)3-5-19-9/h3,5H,2,4,6H2,1H3,(H,16,17) |
| InChIKey | YUQQOZFJQPYHDE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |