C10H12ClF3N4O3 — CID 103109060
ethyl 5-(chloromethyl)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate (PubChem CID 103109060) has the molecular formula C10H12ClF3N4O3 and a molecular weight of 328.68 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109060 |
| Molecular Formula | C10H12ClF3N4O3 |
| Molecular Weight | 328.68 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(=O)NCC(F)(F)F)c1CCl |
| InChI | InChI=1S/C10H12ClF3N4O3/c1-2-21-9(20)8-6(3-11)18(17-16-8)4-7(19)15-5-10(12,13)14/h2-5H2,1H3,(H,15,19) |
| InChIKey | GLOYTEHSGOTHBT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.68 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|