C12H20ClN3O4S — CID 106729310
ethyl 1-(2-tert-butylsulfonylethyl)-5-(chloromethyl)triazole-4-carboxylate (PubChem CID 106729310) has the molecular formula C12H20ClN3O4S and a molecular weight of 337.83 g/mol. Its IUPAC name is ethyl 1-(2-tert-butylsulfonylethyl)-5-(chloromethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(2-tert-butylsulfonylethyl)-5-(chloromethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 106729310 |
| Molecular Formula | C12H20ClN3O4S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | ethyl 1-(2-tert-butylsulfonylethyl)-5-(chloromethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CCS(=O)(=O)C(C)(C)C)c1CCl |
| InChI | InChI=1S/C12H20ClN3O4S/c1-5-20-11(17)10-9(8-13)16(15-14-10)6-7-21(18,19)12(2,3)4/h5-8H2,1-4H3 |
| InChIKey | LCSINEGTIQAQCY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|