C13H23N3O4S — CID 106729280
methyl 1-(2-tert-butylsulfonylethyl)-5-propan-2-yltriazole-4-carboxylate (PubChem CID 106729280) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is methyl 1-(2-tert-butylsulfonylethyl)-5-propan-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-(2-tert-butylsulfonylethyl)-5-propan-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 106729280 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 1-(2-tert-butylsulfonylethyl)-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCS(=O)(=O)C(C)(C)C)c1C(C)C |
| InChI | InChI=1S/C13H23N3O4S/c1-9(2)11-10(12(17)20-6)14-15-16(11)7-8-21(18,19)13(3,4)5/h9H,7-8H2,1-6H3 |
| InChIKey | YZKARNIQPKYCEP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |