About methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate
methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate (PubChem CID 102643911) has the molecular formula C12H17N5O4
and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate |
| PubChem CID | 102643911 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCN2C(=O)CNC2=O)c1C(C)C |
| InChI | InChI=1S/C12H17N5O4/c1-7(2)10-9(11(19)21-3)14-15-17(10)5-4-16-8(18)6-13-12(16)20/h7H,4-6H2,1-3H3,(H,13,20) |
| InChIKey | QOZCVPNNOMSMHM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate?
The IUPAC name of methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate (CID 102643911) is methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate.
What is the SMILES notation for methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate?
The canonical SMILES for methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate is COC(=O)c1nnn(CCN2C(=O)CNC2=O)c1C(C)C.
What is the InChIKey of methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate?
The InChIKey is QOZCVPNNOMSMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O4/c1-7(2)10-9(11(19)21-3)14-15-17(10)5-4-16-8(18)6-13-12(16)20/h7H,4-6H2,1-3H3,(H,13,20).
What are the key properties of methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate?
methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate has a molecular weight of 295.30 g/mol, XLogP of -0.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate is sourced from PubChem (CID 102643911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).