C12H17N5O4 — CID 102643911
methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate (PubChem CID 102643911) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 102643911 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCN2C(=O)CNC2=O)c1C(C)C |
| InChI | InChI=1S/C12H17N5O4/c1-7(2)10-9(11(19)21-3)14-15-17(10)5-4-16-8(18)6-13-12(16)20/h7H,4-6H2,1-3H3,(H,13,20) |
| InChIKey | QOZCVPNNOMSMHM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|