C11H14ClN5O2 — CID 103109473
ethyl 5-(chloromethyl)-1-[(3-methylimidazol-4-yl)methyl]triazole-4-carboxylate (PubChem CID 103109473) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-[(3-methylimidazol-4-yl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-[(3-methylimidazol-4-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109473 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-[(3-methylimidazol-4-yl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2cncn2C)c1CCl |
| InChI | InChI=1S/C11H14ClN5O2/c1-3-19-11(18)10-9(4-12)17(15-14-10)6-8-5-13-7-16(8)2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | JRRLXFCMMVANNE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|