C12H15ClN4O3 — CID 103109444
ethyl 5-(chloromethyl)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate (PubChem CID 103109444) has the molecular formula C12H15ClN4O3 and a molecular weight of 298.73 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109444 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2nc(C)c(C)o2)c1CCl |
| InChI | InChI=1S/C12H15ClN4O3/c1-4-19-12(18)11-9(5-13)17(16-15-11)6-10-14-7(2)8(3)20-10/h4-6H2,1-3H3 |
| InChIKey | PUVNNLXQJPEXTE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|