C11H13ClN4O2S — CID 103109272
ethyl 5-(chloromethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylate (PubChem CID 103109272) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109272 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2csc(C)n2)c1CCl |
| InChI | InChI=1S/C11H13ClN4O2S/c1-3-18-11(17)10-9(4-12)16(15-14-10)5-8-6-19-7(2)13-8/h6H,3-5H2,1-2H3 |
| InChIKey | HHNXCRUMHXSFOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|