C11H14N6O2 — CID 103110946
ethyl 5-(aminomethyl)-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate (PubChem CID 103110946) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(aminomethyl)-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103110946 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 5-(aminomethyl)-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ncccn2)c1CN |
| InChI | InChI=1S/C11H14N6O2/c1-2-19-11(18)10-8(6-12)17(16-15-10)7-9-13-4-3-5-14-9/h3-5H,2,6-7,12H2,1H3 |
| InChIKey | WYPFICSVXGFZAY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |