C14H19N5O2 — CID 103106284
ethyl 5-tert-butyl-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate (PubChem CID 103106284) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103106284 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | ethyl 5-tert-butyl-1-(pyrimidin-2-ylmethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ncccn2)c1C(C)(C)C |
| InChI | InChI=1S/C14H19N5O2/c1-5-21-13(20)11-12(14(2,3)4)19(18-17-11)9-10-15-7-6-8-16-10/h6-8H,5,9H2,1-4H3 |
| InChIKey | RNRHJHGXPMPTJO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |