C14H18N4O2 — CID 103105342
ethyl 5-propan-2-yl-1-(pyridin-2-ylmethyl)triazole-4-carboxylate (PubChem CID 103105342) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 5-propan-2-yl-1-(pyridin-2-ylmethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-propan-2-yl-1-(pyridin-2-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103105342 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethyl 5-propan-2-yl-1-(pyridin-2-ylmethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccccn2)c1C(C)C |
| InChI | InChI=1S/C14H18N4O2/c1-4-20-14(19)12-13(10(2)3)18(17-16-12)9-11-7-5-6-8-15-11/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | UQOLJUFGHIWIPN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |