C14H23N3O3 — CID 103106351
ethyl 5-tert-butyl-1-(2-hydroxycyclopentyl)triazole-4-carboxylate (PubChem CID 103106351) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-(2-hydroxycyclopentyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-(2-hydroxycyclopentyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103106351 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | ethyl 5-tert-butyl-1-(2-hydroxycyclopentyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CCCC2O)c1C(C)(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-5-20-13(19)11-12(14(2,3)4)17(16-15-11)9-7-6-8-10(9)18/h9-10,18H,5-8H2,1-4H3 |
| InChIKey | KAHBJUXISWQWJF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |