C14H22N4O3 — CID 103106476
ethyl 5-tert-butyl-1-(1-methyl-2-oxopyrrolidin-3-yl)triazole-4-carboxylate (PubChem CID 103106476) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-(1-methyl-2-oxopyrrolidin-3-yl)triazole-4-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-(1-methyl-2-oxopyrrolidin-3-yl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103106476 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl 5-tert-butyl-1-(1-methyl-2-oxopyrrolidin-3-yl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CCN(C)C2=O)c1C(C)(C)C |
| InChI | InChI=1S/C14H22N4O3/c1-6-21-13(20)10-11(14(2,3)4)18(16-15-10)9-7-8-17(5)12(9)19/h9H,6-8H2,1-5H3 |
| InChIKey | WFYDHWUTQVTDPM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |