C12H18ClN3O3 — CID 103108880
ethyl 5-(chloromethyl)-1-(2-hydroxycyclohexyl)triazole-4-carboxylate (PubChem CID 103108880) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-(2-hydroxycyclohexyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-(2-hydroxycyclohexyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103108880 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-(2-hydroxycyclohexyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CCCCC2O)c1CCl |
| InChI | InChI=1S/C12H18ClN3O3/c1-2-19-12(18)11-9(7-13)16(15-14-11)8-5-3-4-6-10(8)17/h8,10,17H,2-7H2,1H3 |
| InChIKey | UILOKKBOPOJMIG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|