C12H21N5O3 — CID 103119270
5-(2-aminoethyl)-1-[2-oxo-2-(pentan-2-ylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103119270) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-[2-oxo-2-(pentan-2-ylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethyl)-1-[2-oxo-2-(pentan-2-ylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103119270 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-(2-aminoethyl)-1-[2-oxo-2-(pentan-2-ylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | CCCC(C)NC(=O)Cn1nnc(C(=O)O)c1CCN |
| InChI | InChI=1S/C12H21N5O3/c1-3-4-8(2)14-10(18)7-17-9(5-6-13)11(12(19)20)15-16-17/h8H,3-7,13H2,1-2H3,(H,14,18)(H,19,20) |
| InChIKey | GYRYREITIIEVKG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |