C12H21N5O4 — CID 103121639
5-(aminomethyl)-1-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103121639) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121639 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 5-(aminomethyl)-1-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | CC(C)OCCCNC(=O)Cn1nnc(C(=O)O)c1CN |
| InChI | InChI=1S/C12H21N5O4/c1-8(2)21-5-3-4-14-10(18)7-17-9(6-13)11(12(19)20)15-16-17/h8H,3-7,13H2,1-2H3,(H,14,18)(H,19,20) |
| InChIKey | NIPRYGCAQCYHBV-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|