C24H43N3O11 — CID 139374625
bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate (PubChem CID 139374625) has the molecular formula C24H43N3O11 and a molecular weight of 549.62 g/mol. Its IUPAC name is bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate.
| Compound Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 139374625 |
| Molecular Formula | C24H43N3O11 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate |
| SMILES | COCCOCCOCCOC(=O)c1nnn(CCCCCCO)c1C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C24H43N3O11/c1-31-9-11-33-13-15-35-17-19-37-23(29)21-22(27(26-25-21)7-5-3-4-6-8-28)24(30)38-20-18-36-16-14-34-12-10-32-2/h28H,3-20H2,1-2H3 |
| InChIKey | XOXWYGYBGBSILT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|