About bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate
bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate (PubChem CID 139374625) has the molecular formula C24H43N3O11
and a molecular weight of 549.62 g/mol. Its IUPAC name is bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate |
| PubChem CID | 139374625 |
| Molecular Formula | C24H43N3O11 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate |
| SMILES | COCCOCCOCCOC(=O)c1nnn(CCCCCCO)c1C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C24H43N3O11/c1-31-9-11-33-13-15-35-17-19-37-23(29)21-22(27(26-25-21)7-5-3-4-6-8-28)24(30)38-20-18-36-16-14-34-12-10-32-2/h28H,3-20H2,1-2H3 |
| InChIKey | XOXWYGYBGBSILT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate?
The IUPAC name of bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate (CID 139374625) is bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate.
What is the SMILES notation for bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate?
The canonical SMILES for bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate is COCCOCCOCCOC(=O)c1nnn(CCCCCCO)c1C(=O)OCCOCCOCCOC.
What is the InChIKey of bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate?
The InChIKey is XOXWYGYBGBSILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H43N3O11/c1-31-9-11-33-13-15-35-17-19-37-23(29)21-22(27(26-25-21)7-5-3-4-6-8-28)24(30)38-20-18-36-16-14-34-12-10-32-2/h28H,3-20H2,1-2H3.
What are the key properties of bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate?
bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate has a molecular weight of 549.62 g/mol, XLogP of 0.50, 26 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylate is sourced from PubChem (CID 139374625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).