C9H13F2N3O3 — CID 102644776
5-(difluoromethyl)-1-(2-hydroxy-2-methylbutyl)triazole-4-carboxylic acid (PubChem CID 102644776) has the molecular formula C9H13F2N3O3 and a molecular weight of 249.22 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(2-hydroxy-2-methylbutyl)triazole-4-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-1-(2-hydroxy-2-methylbutyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644776 |
| Molecular Formula | C9H13F2N3O3 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-(difluoromethyl)-1-(2-hydroxy-2-methylbutyl)triazole-4-carboxylic acid |
| SMILES | CCC(C)(O)Cn1nnc(C(=O)O)c1C(F)F |
| InChI | InChI=1S/C9H13F2N3O3/c1-3-9(2,17)4-14-6(7(10)11)5(8(15)16)12-13-14/h7,17H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | HXLHTYABXJQZJX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |