C12H15BrN4O — CID 79542535
1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethyltriazol-4-amine (PubChem CID 79542535) has the molecular formula C12H15BrN4O and a molecular weight of 311.18 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethyltriazol-4-amine.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethyltriazol-4-amine |
|---|---|
| PubChem CID | 79542535 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethyltriazol-4-amine |
| SMILES | CCc1c(N)nnn1Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C12H15BrN4O/c1-3-11-12(14)15-16-17(11)7-8-6-9(18-2)4-5-10(8)13/h4-6H,3,7,14H2,1-2H3 |
| InChIKey | LURXXHAKSBBWNB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |