C11H7BrF3N3O2 — CID 102644739
1-[(3-bromo-4-fluorophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid (PubChem CID 102644739) has the molecular formula C11H7BrF3N3O2 and a molecular weight of 350.09 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644739 |
| Molecular Formula | C11H7BrF3N3O2 |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2ccc(F)c(Br)c2)c1C(F)F |
| InChI | InChI=1S/C11H7BrF3N3O2/c12-6-3-5(1-2-7(6)13)4-18-9(10(14)15)8(11(19)20)16-17-18/h1-3,10H,4H2,(H,19,20) |
| InChIKey | WFAKUEPGJAKUEH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |