C11H8BrF2N3O2 — CID 102644552
1-[(4-bromophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid (PubChem CID 102644552) has the molecular formula C11H8BrF2N3O2 and a molecular weight of 332.10 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(4-bromophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644552 |
| Molecular Formula | C11H8BrF2N3O2 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2ccc(Br)cc2)c1C(F)F |
| InChI | InChI=1S/C11H8BrF2N3O2/c12-7-3-1-6(2-4-7)5-17-9(10(13)14)8(11(18)19)15-16-17/h1-4,10H,5H2,(H,18,19) |
| InChIKey | MXECXNGHGGGVNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |