C12H9BrFNO2 — CID 79113218
1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2-carboxylic acid (PubChem CID 79113218) has the molecular formula C12H9BrFNO2 and a molecular weight of 298.11 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79113218 |
| Molecular Formula | C12H9BrFNO2 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H9BrFNO2/c13-9-6-8(3-4-10(9)14)7-15-5-1-2-11(15)12(16)17/h1-6H,7H2,(H,16,17) |
| InChIKey | IGLWZMAEVWBZKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |