C10H8BrNO2S — CID 131036390
1-[(5-bromothiophen-3-yl)methyl]pyrrole-2-carboxylic acid (PubChem CID 131036390) has the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 131036390 |
| Molecular Formula | C10H8BrNO2S |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1Cc1csc(Br)c1 |
| InChI | InChI=1S/C10H8BrNO2S/c11-9-4-7(6-15-9)5-12-3-1-2-8(12)10(13)14/h1-4,6H,5H2,(H,13,14) |
| InChIKey | XYOJSPWVICLHTL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |