C14H14BrNO2S — CID 107112113
2-[(5-bromothiophen-3-yl)methyl-methylamino]-3-methylbenzoic acid (PubChem CID 107112113) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methyl-methylamino]-3-methylbenzoic acid.
| Compound Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107112113 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C14H14BrNO2S/c1-9-4-3-5-11(14(17)18)13(9)16(2)7-10-6-12(15)19-8-10/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | MKODTTWAQYEKHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |