C14H14BrNO3S — CID 81304608
2-[(5-bromothiophen-3-yl)methyl-methylamino]-4-methoxybenzoic acid (PubChem CID 81304608) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methyl-methylamino]-4-methoxybenzoic acid.
| Compound Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 81304608 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(N(C)Cc2csc(Br)c2)c1 |
| InChI | InChI=1S/C14H14BrNO3S/c1-16(7-9-5-13(15)20-8-9)12-6-10(19-2)3-4-11(12)14(17)18/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | LOJZNHVZPKMCMY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |