C14H13BrFNOS — CID 54982109
1-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorophenyl]ethanone (PubChem CID 54982109) has the molecular formula C14H13BrFNOS and a molecular weight of 342.23 g/mol. Its IUPAC name is 1-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorophenyl]ethanone.
| Compound Name | 1-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 54982109 |
| Molecular Formula | C14H13BrFNOS |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C14H13BrFNOS/c1-9(18)12-6-11(16)3-4-13(12)17(2)7-10-5-14(15)19-8-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | GLROBACRUKVRRO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |