C13H10BrFN2S — CID 55231921
2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorobenzonitrile (PubChem CID 55231921) has the molecular formula C13H10BrFN2S and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorobenzonitrile.
| Compound Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 55231921 |
| Molecular Formula | C13H10BrFN2S |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-5-fluorobenzonitrile |
| SMILES | CN(Cc1csc(Br)c1)c1ccc(F)cc1C#N |
| InChI | InChI=1S/C13H10BrFN2S/c1-17(7-9-4-13(14)18-8-9)12-3-2-11(15)5-10(12)6-16/h2-5,8H,7H2,1H3 |
| InChIKey | BMRXEKGUQIPKPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |