C11H9ClN4O3S — CID 135501641
4-amino-2-[(2-chloro-4-nitrophenyl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135501641) has the molecular formula C11H9ClN4O3S and a molecular weight of 312.74 g/mol. Its IUPAC name is 4-amino-2-[(2-chloro-4-nitrophenyl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(2-chloro-4-nitrophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135501641 |
| Molecular Formula | C11H9ClN4O3S |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-amino-2-[(2-chloro-4-nitrophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C11H9ClN4O3S/c12-8-3-7(16(18)19)2-1-6(8)5-20-11-14-9(13)4-10(17)15-11/h1-4H,5H2,(H3,13,14,15,17) |
| InChIKey | ILPHZOWIIBVNCE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|